Systematic / IUPAC Name: (2E)-1,3-Diphenyl-2-propen-1-one
ID: Reference1328
Other Names:
Benzylideneacetophenone;
2-Benzylideneacetophenone;
2-Propen-1-one, 1,3-diphenyl-;
Styryl phenyl ketone;
3-Phenylacrylophenone
; more
Formula: C15H12O
Class: Endogenous Metabolites
Chalcone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1273 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:40:26 AM |
| InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11+ |
| InChI Key | DQFBYFPFKXHELB-VAWYXSNFSA-N |
| Canonical SMILES | |
| CAS | 614471 |
| Splash | |
| Other Names |
Benzylideneacetophenone; 2-Benzylideneacetophenone; 2-Propen-1-one, 1,3-diphenyl-; Styryl phenyl ketone; 3-Phenylacrylophenone; β-Phenylacrylophenone; 1-Phenyl-2-benzoylethylene; Acrylophenone, 3-phenyl-; Phenyl 2-phenylvinyl ketone; Phenyl (E)-2-phenylethenyl ketone; 1-Benzoyl-2-phenylethylene; trans-Chalcone; (E)-Chalcone; Benzalacetophenone; Chalkone; 2-Benzalacetophenone; trans-Benzalacetophenone |
| ChEMBL | CHEMBL7976 |
| PubChem | 637760 |
| KEGG | C01484; C15589 |
| ChEBI | CHEBI:48965 |
| ChemSpider | 553346 |
| Wikipedia | Chalcone |
| ChemIDPlus | 000094417; 000614471 |
| HMDb | HMDB03066 |