Systematic / IUPAC Name: N-Methylperfluorooctanesulfonamide
ID: Reference13280
Other Names: AA-1608
Formula: C9H4F17NO2S
Class: Perfluorinated Hydrocarbons
Heptadecafluoro-N-methyloctanesulphonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 780 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/27/2024 8:31:07 AM |
| InChI | InChI=1S/C9H4F17NO2S/c1-27-30(28,29)9(25,26)7(20,21)5(16,17)3(12,13)2(10,11)4(14,15)6(18,19)8(22,23)24/h27H,1H3 |
| InChI Key | SRMWNTGHXHOWBT-UHFFFAOYSA-N |
| Canonical SMILES | CNS(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| CAS | |
| Splash | |
| Other Names | AA-1608 |