Systematic / IUPAC Name:
ID: Reference13281
Other Names: AA-1615A
Formula: C8HF15O2
Class: Perfluorinated Hydrocarbons
2,2,3,3,4,4,5,6,6,7,7,7-Dodecafluoro-5-(trifluoromethyl)heptanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 390 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/4/2024 1:55:42 PM |
| InChI | InChI=1S/C8HF15O2/c9-2(10,1(24)25)4(12,13)5(14,15)3(11,7(18,19)20)6(16,17)8(21,22)23/h(H,24,25) |
| InChI Key | HDWNCRCOUUAYQG-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | AA-1615A |
| PubChem | 101561191 |