Systematic / IUPAC Name:
ID: Reference13283
Other Names: AA-1618
Formula: C7H2F15NO2S
Class: Perfluorinated Hydrocarbons
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 265 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2024 2:13:52 PM |
| InChI | InChI=1S/C7H2F15NO2S/c8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)26(23,24)25/h(H2,23,24,25) |
| InChI Key | ZYBNLNNCZHCXAC-UHFFFAOYSA-N |
| Canonical SMILES | FC(F)(C(F)(F)S(N)(=O)=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | AA-1618 |