Systematic / IUPAC Name:
ID: Reference13286
Other Names: AA-1647
Formula: C14HF30O2P
Class: Perfluorinated Hydrocarbons
(Heptadecafluorooctyl)(tridecafluorohexyl)phosphinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 445 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2024 2:17:01 PM |
| InChI | InChI=1S/C14HF30O2P/c15-1(16,3(19,20)7(27,28)11(35,36)37)2(17,18)5(23,24)9(31,32)13(41,42)47(45,46)14(43,44)10(33,34)6(25,26)4(21,22)8(29,30)12(38,39)40/h(H,45,46) |
| InChI Key | CQORQFOHIKVJET-UHFFFAOYSA-N |
| Canonical SMILES | FC(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)P(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | AA-1647 |