Systematic / IUPAC Name: 3-(Difluoromethyl)-1-methyl-N-(3',4',5'-trifluoro[1,1'-biphenyl]-2-yl)-1H-pyrazole-4-carboxamide
ID: Reference13288
Other Names: AA-1426
Formula: C18H12F5N3O
Class: Pesticides/Herbicides
Fluxapyroxad mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2985 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/31/2024 12:59:42 PM |
| InChI | InChI=1S/C18H12F5N3O/c1-26-8-11(16(25-26)17(22)23)18(27)24-14-5-3-2-4-10(14)9-6-12(19)15(21)13(20)7-9/h2-8,17H,1H3,(H,24,27) |
| InChI Key | SXSGXWCSHSVPGB-UHFFFAOYSA-N |
| Canonical SMILES | FC(F)c1nn(C)cc1C(=O)Nc1ccccc1c1cc(F)c(F)c(F)c1 |
| CAS | |
| Splash | |
| Other Names | AA-1426 |