Systematic / IUPAC Name: 6-Chloropyridine-3-carboxylic acid
ID: Reference13290
Other Names: AA-1393
Formula: C6H4ClNO2
Class: Pesticides/Herbicides
6-Chloronicotinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 389 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/31/2024 1:40:41 PM |
| InChI | InChI=1S/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10) |
| InChI Key | UAWMVMPAYRWUFX-UHFFFAOYSA-N |
| Canonical SMILES | OC(=O)c1cnc(Cl)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-1393 |