Systematic / IUPAC Name: 2-(2-Furyl)-1H-benzimidazol
ID: Reference13291
Other Names: AA-1427
Formula: C11H8N2O
Class: Pesticides/Herbicides
Fuberidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 510 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/25/2024 3:25:35 PM |
| InChI | InChI=1S/C11H8N2O/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10/h1-7H,(H,12,13) |
| InChI Key | UYJUZNLFJAWNEZ-UHFFFAOYSA-N |
| Canonical SMILES | c1ccc2c(c1)[nH]c(n2)c3ccco3 |
| CAS | |
| Splash | |
| Other Names | AA-1427 |