Systematic / IUPAC Name: 3-(Difluoromethyl)-N-(11-isopropyltricyclo[6.2.1.02,7]undeca-2,4,6-trien-3-yl)-1-methyl-1H-pyrazole-4-carboxamide
ID: Reference13297
Other Names: AA-1433
Formula: C20H23F2N3O
Class: Pesticides/Herbicides
Isopyrazam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4775 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/31/2024 12:41:46 PM |
| InChI | InChI=1S/C20H23F2N3O/c1-10(2)16-12-7-8-13(16)17-11(12)5-4-6-15(17)23-20(26)14-9-25(3)24-18(14)19(21)22/h4-6,9-10,12-13,16,19H,7-8H2,1-3H3,(H,23,26) |
| InChI Key | XTDZGXBTXBEZDN-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C1C2CCC1c3c2cccc3NC(=O)c4cn(nc4C(F)F)C |
| CAS | |
| Splash | |
| Other Names | AA-1433 |