Systematic / IUPAC Name: Ethyl (Z)-2-chloro-3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)phenyl]prop-2-enoate
ID: Reference13307
Other Names: AA-1408
Formula: C19H17Cl2NO4
Class: Pesticides/Herbicides
Cinidon-ethyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2540 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/25/2024 2:13:52 PM |
| InChI | InChI=1S/C19H17Cl2NO4/c1-2-26-19(25)16(21)10-11-9-12(7-8-15(11)20)22-17(23)13-5-3-4-6-14(13)18(22)24/h7-10H,2-6H2,1H3/b16-10- |
| InChI Key | NNKKTZOEKDFTBU-YBEGLDIGSA-N |
| Canonical SMILES | CCOC(=O)/C(=C/C1=C(C=CC(=C1)N2C(=O)C3=C(C2=O)CCCC3)Cl)/Cl |
| CAS | |
| Splash | |
| Other Names | AA-1408 |