Systematic / IUPAC Name:
ID: Reference13321
Other Names:
Tricyclohexyltin hydroxide;
AA-1549
Formula: C18H34OSn
Class: Pesticides/Herbicides
Cyhexatin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1018 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/10/2025 1:44:42 PM |
| InChI | InChI=1S/3C6H11.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;1H2; |
| InChI Key | UGCNRZFAUBJVPT-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)[Sn](C2CCCCC2)C3CCCCC3.O |
| CAS | |
| Splash | |
| Other Names |
Tricyclohexyltin hydroxide; AA-1549 |
| PubChem | 6327054 |