Systematic / IUPAC Name: N-Phenylaniline
ID: Reference1333
Other Names:
Anilinobenzene;
N-Phenylbenzenamine;
Benzenamine, N-phenyl-;
N,N-Diphenylamine;
Benzene, anilino-
; more
Formula: C12H11N
Class: Excipients/Additives/Colorants
Diphenylamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 621 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:31:31 AM |
| InChI | InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| CAS | 122394 |
| Splash | |
| Other Names |
Anilinobenzene; N-Phenylbenzenamine; Benzenamine, N-phenyl-; N,N-Diphenylamine; Benzene, anilino-; N-Phenylbenzeneamine; Aniline, N-phenyl-; Diphenyl amine; Scaldip; Big dipper; Difenylamin; No Scald |
| ChEBI | CHEBI:4640 |
| Wikipedia | Diphenylamine |
| ChEMBL | CHEMBL38688 |
| KEGG | C11016 |
| ChemSpider | 11003 |
| PubChem | 11487 |
| ChemIDPlus | 000122394; 068442682 |
| HMDb | HMDB32562 |