Systematic / IUPAC Name: S-Benzyl N-ethyl-N-(3-methylbutan-2-yl)carbamothioate
ID: Reference13353
Other Names: AA-1792
Formula: C15H23NOS
Esprocarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 510 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2025 9:53:02 AM |
| InChI | InChI=1S/C15H23NOS/c1-5-16(13(4)12(2)3)15(17)18-11-14-9-7-6-8-10-14/h6-10,12-13H,5,11H2,1-4H3 |
| InChI Key | BXEHUCNTIZGSOJ-UHFFFAOYSA-N |
| Canonical SMILES | CCN(C(C)C(C)C)C(=O)SCC1=CC=CC=C1 |
| CAS | |
| Splash | |
| Other Names | AA-1792 |
| PubChem | 91740 |