Systematic / IUPAC Name: 1-(4,6-Dimethoxypyrimidin-2-yl)-3-[3-(trifluoromethyl)pyridin-2-yl]sulfonylurea
ID: Reference13354
Other Names: AA-1544
Formula: C13H12F3N5O5S
Class: Pesticides/Herbicides
Flazasulfuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4497 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/7/2025 1:42:15 PM |
| InChI | InChI=1S/C13H12F3N5O5S/c1-25-8-6-9(26-2)19-11(18-8)20-12(22)21-27(23,24)10-7(13(14,15)16)4-3-5-17-10/h3-6H,1-2H3,(H2,18,19,20,21,22) |
| InChI Key | HWATZEJQIXKWQS-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=CC=N2)C(F)(F)F)OC |
| CAS | |
| Splash | |
| Other Names | AA-1544 |