Systematic / IUPAC Name: N-[(6aS,8S)-2-(2,3-Dimethylphenyl)-6,12-dioxo-5,6,6a,7,8,9,10,12-octahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-pyrazinecarboxamide
ID: Reference13355
Other Names: NAT7-330123
Formula: C26H25N5O3
N-[(6aS,8S)-2-(2,3-Dimethylphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]pyrazine-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2992 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/7/2025 1:52:04 PM |
| InChI | InChI=1S/C26H25N5O3/c1-15-4-3-5-19(16(15)2)17-6-7-21-20(12-17)26(34)31-11-8-18(13-23(31)25(33)30-21)29-24(32)22-14-27-9-10-28-22/h3-7,9-10,12,14,18,23H,8,11,13H2,1-2H3,(H,29,32)(H,30,33)/t18-,23-/m0/s1 |
| InChI Key | AJOSHYXDARWRRH-MBSDFSHPSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C2=CC3=C(C=C2)NC(=O)C4CC(CCN4C3=O)NC(=O)C5=NC=CN=C5)C |
| CAS | |
| Splash | |
| Other Names | NAT7-330123 |
| PubChem | 11943110 |