Systematic / IUPAC Name: Propan-2-yl N-(2-methoxy-5-phenylanilino)carbamate
ID: Reference13364
Other Names: AA-1571
Formula: C17H20N2O3
Class: Pesticides/Herbicides
Bifenazate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1293 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/14/2025 9:16:52 AM |
| InChI | InChI=1S/C17H20N2O3/c1-12(2)22-17(20)19-18-15-11-14(9-10-16(15)21-3)13-7-5-4-6-8-13/h4-12,18H,1-3H3,(H,19,20) |
| InChI Key | VHLKTXFWDRXILV-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)NNC1=C(C=CC(=C1)C2=CC=CC=C2)OC |
| CAS | |
| Splash | |
| Other Names | AA-1571 |
| PubChem | 176879 |