Systematic / IUPAC Name:
ID: Reference13366
Other Names: NAT6-298540
Formula: C26H23N9O4
1-[(3S,3aR,6S,6aR)-6-[5-[4-(1,2,4-Triazol-1-yl)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2568 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/14/2025 9:35:04 AM |
| InChI | InChI=1S/C26H23N9O4/c36-25(29-20-7-3-5-16-4-1-2-6-19(16)20)30-21-12-37-24-22(13-38-23(21)24)35-26(31-32-33-35)39-18-10-8-17(9-11-18)34-15-27-14-28-34/h1-11,14-15,21-24H,12-13H2,(H2,29,30,36)/t21-,22-,23+,24+/m0/s1 |
| InChI Key | PDHMQOSDTQTUSA-CJRSTVEYSA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)N3C(=NN=N3)OC4=CC=C(C=C4)N5C=NC=N5)NC(=O)NC6=CC=CC7=CC=CC=C76 |
| CAS | |
| Splash | |
| Other Names | NAT6-298540 |
| PubChem | 11886264 |