Systematic / IUPAC Name: 1,4:3,6-Dianhydro-2,5-dideoxy-2-{5-[3-(4-morpholinyl)phenoxy]-1H-tetrazol-1-yl}-5-[(2-naphthylsulfonyl)amino]-L-iditol
ID: Reference13367
Other Names: NAT6-298482
Formula: C27H28N6O6S
N-[(3S,3aR,6S,6aR)-6-[5-(3-Morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]naphthalene-2-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2517 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/14/2025 9:36:03 AM |
| InChI | InChI=1S/C27H28N6O6S/c34-40(35,22-9-8-18-4-1-2-5-19(18)14-22)29-23-16-37-26-24(17-38-25(23)26)33-27(28-30-31-33)39-21-7-3-6-20(15-21)32-10-12-36-13-11-32/h1-9,14-15,23-26,29H,10-13,16-17H2/t23-,24-,25+,26+/m0/s1 |
| InChI Key | XETJYRIQYKFHFC-QEGGNFSNSA-N |
| Canonical SMILES | C1COCCN1C2=CC(=CC=C2)OC3=NN=NN3C4COC5C4OCC5NS(=O)(=O)C6=CC7=CC=CC=C7C=C6 |
| CAS | |
| Splash | |
| Other Names | NAT6-298482 |
| PubChem | 11879616 |