Systematic / IUPAC Name: N,N-Dimethyl-2,2-diphenylacetamide
ID: Reference13373
Other Names: AA-1810
Formula: C16H17NO
Class: Pesticides/Herbicides
Diphenamid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 500 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2025 9:48:57 AM |
| InChI | InChI=1S/C16H17NO/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3 |
| InChI Key | QAHFOPIILNICLA-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | AA-1810 |
| PubChem | 13728 |