Systematic / IUPAC Name: 4-Bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile
ID: Reference13384
Other Names: AA-1579
Formula: C15H11BrClF3N2O
Class: Pesticides/Herbicides
Chlorfenapyr mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5353 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2025 9:23:53 AM |
| InChI | InChI=1S/C15H11BrClF3N2O/c1-2-23-8-22-13(9-3-5-10(17)6-4-9)11(7-21)12(16)14(22)15(18,19)20/h3-6H,2,8H2,1H3 |
| InChI Key | CWFOCCVIPCEQCK-UHFFFAOYSA-N |
| Canonical SMILES | CCOCN1C(=C(C(=C1C(F)(F)F)Br)C#N)C2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names | AA-1579 |
| PubChem | 91778 |