Systematic / IUPAC Name: 6-Amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid
ID: Reference13385
Other Names: AA-1672
Formula: C8H8ClN3O2
Class: Pesticides/Herbicides
Aminocyclopyrachlor mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1075 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2025 9:25:42 AM |
| InChI | InChI=1S/C8H8ClN3O2/c9-4-5(8(13)14)11-7(3-1-2-3)12-6(4)10/h3H,1-2H2,(H,13,14)(H2,10,11,12) |
| InChI Key | KWAIHLIXESXTJL-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1C2=NC(=C(C(=N2)N)Cl)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-1672 |
| PubChem | 17747875 |