Systematic / IUPAC Name: [2-(Ethylsulfanylmethyl)phenyl] N-methylcarbamate
ID: Reference13390
Other Names: AA-1681
Formula: C11H15NO2S
Ethiofencarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1250 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/15/2025 10:57:46 AM |
| InChI | InChI=1S/C11H15NO2S/c1-3-15-8-9-6-4-5-7-10(9)14-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13) |
| InChI Key | HEZNVIYQEUHLNI-UHFFFAOYSA-N |
| Canonical SMILES | CCSCC1=CC=CC=C1OC(=O)NC |
| CAS | |
| Splash | |
| Other Names | AA-1681 |
| PubChem | 34766 |