Systematic / IUPAC Name: (6-Ethoxy-2-ethylpyrimidin-4-yl)oxy-dimethoxy-sulfanylidene-λ5-phosphane
ID: Reference13391
Other Names: AA-1682
Formula: C10H17N2O4PS
Class: Pesticides/Herbicides
Etrimfos mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1677 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/15/2025 10:56:04 AM |
| InChI | InChI=1S/C10H17N2O4PS/c1-5-8-11-9(15-6-2)7-10(12-8)16-17(18,13-3)14-4/h7H,5-6H2,1-4H3 |
| InChI Key | FGIWFCGDPUIBEZ-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=NC(=CC(=N1)OP(=S)(OC)OC)OCC |
| CAS | |
| Splash | |
| Other Names | AA-1682 |
| PubChem | 37995 |