Systematic / IUPAC Name: Methyl 2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoate
ID: Reference13393
Other Names: AA-1680
Formula: C15H18N6O6S
Class: Pesticides/Herbicides
Ethametsulfuron-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 875 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2025 7:51:46 PM |
| InChI | InChI=1S/C15H18N6O6S/c1-4-27-15-19-12(16-2)17-13(20-15)18-14(23)21-28(24,25)10-8-6-5-7-9(10)11(22)26-3/h5-8H,4H2,1-3H3,(H3,16,17,18,19,20,21,23) |
| InChI Key | ZINJLDJMHCUBIP-UHFFFAOYSA-N |
| Canonical SMILES | CCOC1=NC(=NC(=N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC)NC |
| CAS | |
| Splash | |
| Other Names | AA-1680 |
| PubChem | 91756 |