Systematic / IUPAC Name: 5-Bromo-N-[2-bromo-4-chloro-6-(1-cyclopropylethylcarbamoyl)phenyl]-2-(3-chloropyridin-2-yl)pyrazole-3-carboxamide
ID: Reference13397
Other Names: AA-1695
Formula: C21H17Br2Cl2N5O2
Class: Pesticides/Herbicides
Cyclaniliprole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1424 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2025 10:23:20 PM |
| InChI | InChI=1S/C21H17Br2Cl2N5O2/c1-10(11-4-5-11)27-20(31)13-7-12(24)8-14(22)18(13)28-21(32)16-9-17(23)29-30(16)19-15(25)3-2-6-26-19/h2-3,6-11H,4-5H2,1H3,(H,27,31)(H,28,32) |
| InChI Key | RAMUASXTSSXCMB-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1CC1)NC(=O)C2=C(C(=CC(=C2)Cl)Br)NC(=O)C3=CC(=NN3C4=C(C=CC=N4)Cl)Br |
| CAS | |
| Splash | |
| Other Names | AA-1695 |
| PubChem | 24822142 |