Systematic / IUPAC Name: 2-[(E)-N-Ethoxy-C-propylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one
ID: Reference13402
Other Names: AA-1705
Formula: C17H27NO3S
Class: Pesticides/Herbicides
Cycloxydim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2424 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/17/2025 10:05:13 AM |
| InChI | InChI=1S/C17H27NO3S/c1-3-6-14(18-21-4-2)17-15(19)9-13(10-16(17)20)12-7-5-8-22-11-12/h12-13,19H,3-11H2,1-2H3/b18-14+ |
| InChI Key | GGWHBJGBERXSLL-NBVRZTHBSA-N |
| Canonical SMILES | CCCC(=NOCC)C1=C(CC(CC1=O)C2CCCSC2)O |
| CAS | |
| Splash | |
| Other Names | AA-1705 |
| PubChem | 135438605 |