Systematic / IUPAC Name: 5-Ethyl-6-octyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
ID: Reference13403
Other Names: AA-1726
Formula: C15H25N5
Class: Pesticides/Herbicides
Ametoctradin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 706 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/28/2025 10:00:58 AM |
| InChI | InChI=1S/C15H25N5/c1-3-5-6-7-8-9-10-12-13(4-2)19-15-17-11-18-20(15)14(12)16/h11H,3-10,16H2,1-2H3 |
| InChI Key | GGKQIOFASHYUJZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCC1=C(N2C(=NC=N2)N=C1CC)N |
| CAS | |
| Splash | |
| Other Names | AA-1726 |
| PubChem | 15604010 |