Systematic / IUPAC Name: 2-Iodo-N-phenylbenzamide
ID: Reference13408
Other Names: AA-1730
Formula: C13H10INO
Class: Pesticides/Herbicides
Benodanil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 834 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/13/2025 7:55:33 AM |
| InChI | InChI=1S/C13H10INO/c14-12-9-5-4-8-11(12)13(16)15-10-6-2-1-3-7-10/h1-9H,(H,15,16) |
| InChI Key | LJOZMWRYMKECFF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2I |
| CAS | |
| Splash | |
| Other Names | AA-1730 |
| PubChem | 27195 |