Systematic / IUPAC Name: 9-Methoxy-7H-furo[3,2-g]chromen-7-one
ID: Reference1342
Other Names:
8-Methoxypsoralene;
8-Methoxyfuranocoumarin;
Methoxy-8-psoralen;
7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy-;
O-Methylxanthotoxol
; more
Formula: C12H8O4
Class: Therapeutics/Prescription Drugs Endogenous Metabolites Natural Products/Medicines
Methoxsalen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1370 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 2/20/2015 2:00:19 PM |
| InChI | InChI=1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3 |
| InChI Key | QXKHYNVANLEOEG-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |
| CAS | 298817 |
| Splash | |
| Other Names |
8-Methoxypsoralene; 8-Methoxyfuranocoumarin; Methoxy-8-psoralen; 7H-Furo[3,2-g][1]benzopyran-7-one, 9-methoxy-; O-Methylxanthotoxol; 9-Methoxyfuro[3,2-g][1]benzopyran-7-one; 6-Hydroxy-7-methoxy-5-benzofuranacrylic acid δ-lactone; 5-Benzofuranacrylic acid, 6-hydroxy-7-methoxy-, δ-lactone; Xanthotoxin; Ammoidin; Meladinine; Oxsoralen; Oxypsoralen; Meloxine; Puvalen; Meladinin; Ammodin; Uvadex; Meladoxen; Xanthotoxine; Geroxalen; Methoxalen; Puvamet; Deltasoralen; Zanthotoxin; Oxoralen; Proralone; Psoralen; Psoralon; Dltasoralen; Methoxaten; Metoxaleno; Ultramop lotion; 7-Furocoumarin; Methoxsalen, 8-; Ultramop; Dermox |
| KEGG | C01864; D00139 |
| ChemSpider | 3971 |
| ChEMBL | CHEMBL416 |
| Wikipedia | Methoxsalen |
| HMDb | HMDB14693 |
| DrugBank | APRD00157 |
| ChemIDPlus | 000298817 |
| ChEBI | CHEBI:18358 |
| PubChem | 4114 |