Systematic / IUPAC Name: 2-[(E)-N-[(E)-3-Chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one
ID: Reference13422
Other Names: AA-1820
Formula: C17H26ClNO3S
Class: Pesticides/Herbicides
Clethodim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 6781 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/19/2025 11:53:47 AM |
| InChI | InChI=1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6+,19-14+ |
| InChI Key | SILSDTWXNBZOGF-KUZBFYBWSA-N |
| Canonical SMILES | CCC(=NOCC=CCl)C1=C(CC(CC1=O)CC(C)SCC)O |
| CAS | |
| Splash | |
| Other Names | AA-1820 |
| PubChem | 135491728 |