Systematic / IUPAC Name: 2-N-[(1R,2S)-2,6-Dimethyl-2,3-dihydro-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine
ID: Reference13423
Other Names: AA-1865
Formula: C16H20FN5
Class: Pesticides/Herbicides
Indaziflam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 689 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/19/2025 11:58:06 AM |
| InChI | InChI=1S/C16H20FN5/c1-8-4-5-11-7-9(2)13(12(11)6-8)19-16-21-14(10(3)17)20-15(18)22-16/h4-6,9-10,13H,7H2,1-3H3,(H3,18,19,20,21,22)/t9-,10?,13+/m0/s1 |
| InChI Key | YFONKFDEZLYQDH-BOURZNODSA-N |
| Canonical SMILES | CC1CC2=C(C1NC3=NC(=NC(=N3)N)C(C)F)C=C(C=C2)C |
| CAS | |
| Splash | |
| Other Names | AA-1865 |
| PubChem | 44146693 |