Systematic / IUPAC Name: 3-(4-Bromo-3-chlorophenyl)-1-methoxy-1-methylurea
ID: Reference13424
Other Names: Aa-1779
Formula: C9H10BrClN2O2
Class: Pesticides/Herbicides
Chlorbromuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 884 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/19/2025 12:05:07 PM |
| InChI | InChI=1S/C9H10BrClN2O2/c1-13(15-2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
| InChI Key | NLYNUTMZTCLNOO-UHFFFAOYSA-N |
| Canonical SMILES | CN(C(=O)NC1=CC(=C(C=C1)Br)Cl)OC |
| CAS | |
| Splash | |
| Other Names | Aa-1779 |
| PubChem | 25912 |