Systematic / IUPAC Name: Butyl (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate
ID: Reference13425
Other Names: AA-1788
Formula: C20H20FNO4
Class: Pesticides/Herbicides
Cyhalofop-butyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1248 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/19/2025 12:10:25 PM |
| InChI | InChI=1S/C20H20FNO4/c1-3-4-11-24-20(23)14(2)25-16-6-8-17(9-7-16)26-19-10-5-15(13-22)12-18(19)21/h5-10,12,14H,3-4,11H2,1-2H3/t14-/m1/s1 |
| InChI Key | TYIYMOAHACZAMQ-CQSZACIVSA-N |
| Canonical SMILES | CCCCOC(=O)C(C)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)C#N)F |
| CAS | |
| Splash | |
| Other Names | AA-1788 |
| PubChem | 180089 |