Systematic / IUPAC Name: 3,5-Dimethyl-1,3,5-thiadiazinane-2-thione
ID: Reference13432
Other Names: AA-1823
Formula: C5H10N2S2
Class: Pesticides/Herbicides
Dazomet mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 464 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/2/2025 11:06:07 AM |
| InChI | InChI=1S/C5H10N2S2/c1-6-3-7(2)5(8)9-4-6/h3-4H2,1-2H3 |
| InChI Key | QAYICIQNSGETAS-UHFFFAOYSA-N |
| Canonical SMILES | CN1CN(C(=S)SC1)C |
| CAS | |
| Splash | |
| Other Names | AA-1823 |
| PubChem | 10788 |