Systematic / IUPAC Name: 2,5-Dimethyl-4-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one
ID: Reference13438
Other Names: AA-1909
Formula: C14H13F3N2O4S
Class: Pesticides/Herbicides
Pyrasulfotole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 949 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/2/2025 9:22:19 AM |
| InChI | InChI=1S/C14H13F3N2O4S/c1-7-11(13(21)19(2)18-7)12(20)9-5-4-8(14(15,16)17)6-10(9)24(3,22)23/h4-6,18H,1-3H3 |
| InChI Key | CZRVDACSCJKRFL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=O)N(N1)C)C(=O)C2=C(C=C(C=C2)C(F)(F)F)S(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names | AA-1909 |
| PubChem | 11693711 |