Systematic / IUPAC Name: Propan-2-yl N-(3,4-diethoxyphenyl)carbamate
ID: Reference13443
Other Names: AA-1823
Formula: C14H21NO4
Class: Pesticides/Herbicides
Diethofencarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4133 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/2/2025 9:06:04 AM |
| InChI | InChI=1S/C14H21NO4/c1-5-17-12-8-7-11(9-13(12)18-6-2)15-14(16)19-10(3)4/h7-10H,5-6H2,1-4H3,(H,15,16) |
| InChI Key | LNJNFVJKDJYTEU-UHFFFAOYSA-N |
| Canonical SMILES | CCOC1=C(C=C(C=C1)NC(=O)OC(C)C)OCC |
| CAS | |
| Splash | |
| Other Names | AA-1823 |
| PubChem | 91742 |