Systematic / IUPAC Name: Propan-2-yl 2-[ethoxy-(propan-2-ylamino)phosphoryl]oxybenzoate
ID: Reference13445
Other Names: AA-1832
Formula: C15H24NO5P
Class: Pesticides/Herbicides
Isofenphos-oxon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 348 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/2/2025 8:08:47 AM |
| InChI | InChI=1S/C15H24NO5P/c1-6-19-22(18,16-11(2)3)21-14-10-8-7-9-13(14)15(17)20-12(4)5/h7-12H,6H2,1-5H3,(H,16,18) |
| InChI Key | DZUPKTNAUCDVTL-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=O)(NC(C)C)OC1=CC=CC=C1C(=O)OC(C)C |
| CAS | |
| Splash | |
| Other Names | AA-1832 |
| PubChem | 35736 |