Systematic / IUPAC Name: N-[2,4-Dimethyl-5-(trifluoromethylsulfonylamino)phenyl]acetamide
ID: Reference13448
Other Names: AA-1839
Formula: C11H13F3N2O3S
Class: Pesticides/Herbicides
Mefluidide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1453 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2025 8:47:28 AM |
| InChI | InChI=1S/C11H13F3N2O3S/c1-6-4-7(2)10(5-9(6)15-8(3)17)16-20(18,19)11(12,13)14/h4-5,16H,1-3H3,(H,15,17) |
| InChI Key | OKIBNKKYNPBDRS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1NC(=O)C)NS(=O)(=O)C(F)(F)F)C |
| CAS | |
| Splash | |
| Other Names | AA-1839 |
| PubChem | 40896 |