Systematic / IUPAC Name: 5-Fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide
ID: Reference13449
Other Names: AA-1925
Formula: C18H24FN3O
Class: Pesticides/Herbicides
Penflufen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 757 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2025 8:50:09 AM |
| InChI | InChI=1S/C18H24FN3O/c1-11(2)10-12(3)14-8-6-7-9-15(14)20-18(23)16-13(4)21-22(5)17(16)19/h6-9,11-12H,10H2,1-5H3,(H,20,23) |
| InChI Key | GOFJDXZZHFNFLV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C(=C1C(=O)NC2=CC=CC=C2C(C)CC(C)C)F)C |
| CAS | |
| Splash | |
| Other Names | AA-1925 |
| PubChem | 11674113 |