Systematic / IUPAC Name: Propan-2-yl N-phenylcarbamate
ID: Reference13451
Other Names: AA-1944
Formula: C10H13NO2
Class: Pesticides/Herbicides
Propham mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 950 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2025 8:54:03 AM |
| InChI | InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12) |
| InChI Key | VXPLXMJHHKHSOA-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)NC1=CC=CC=C1 |
| CAS | |
| Splash | |
| Other Names | AA-1944 |
| PubChem | 24685 |