Systematic / IUPAC Name: 2-Chloro-N-(2-ethyl-6-methylphenyl)-N-(propan-2-yloxymethyl)acetamide
ID: Reference13452
Other Names: AA-1945
Formula: C15H22ClNO2
Class: Pesticides/Herbicides
Propisochlor mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2402 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2025 9:25:37 AM |
| InChI | InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-12(4)15(13)17(14(18)9-16)10-19-11(2)3/h6-8,11H,5,9-10H2,1-4H3 |
| InChI Key | KZNDFYDURHAESM-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC(=C1N(COC(C)C)C(=O)CCl)C |
| CAS | |
| Splash | |
| Other Names | AA-1945 |
| PubChem | 167454 |