Systematic / IUPAC Name: 2-[(4,6-Dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]-N,N-dimethylbenzamide
ID: Reference13454
Other Names: AA-1857
Formula: C16H20N6O6S
Class: Pesticides/Herbicides
Orthosulfamuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2859 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2025 9:45:36 AM |
| InChI | InChI=1S/C16H20N6O6S/c1-22(2)14(23)10-7-5-6-8-11(10)20-29(25,26)21-16(24)19-15-17-12(27-3)9-13(18-15)28-4/h5-9,20H,1-4H3,(H2,17,18,19,21,24) |
| InChI Key | UCDPMNSCCRBWIC-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=O)C1=CC=CC=C1NS(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
| CAS | |
| Splash | |
| Other Names | AA-1857 |
| PubChem | 11091168 |