Systematic / IUPAC Name: (2,2-Dimethyl-3H-1-benzofuran-7-yl) N-[butoxycarbonyl(methyl)amino]sulfanyl-N-methylcarbamate
ID: Reference13461
Other Names: AA-1951
Formula: C18H26N2O5S
Class: Pesticides/Herbicides
Furathiocarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 5040 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/20/2025 8:15:09 AM |
| InChI | InChI=1S/C18H26N2O5S/c1-6-7-11-23-16(21)19(4)26-20(5)17(22)24-14-10-8-9-13-12-18(2,3)25-15(13)14/h8-10H,6-7,11-12H2,1-5H3 |
| InChI Key | HAWJXYBZNNRMNO-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)N(C)SN(C)C(=O)OC1=CC=CC2=C1OC(C2)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-1951 |
| PubChem | 47759 |