Systematic / IUPAC Name: N-[4-Chloro-2-[hydroxy(phenyl)methyl]phenyl]pyridine-4-carboxamide
ID: Reference13463
Other Names: AA-1954
Formula: C19H15ClN2O2
Class: Pesticides/Herbicides
Inabenfide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1364 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/20/2025 8:46:10 AM |
| InChI | InChI=1S/C19H15ClN2O2/c20-15-6-7-17(22-19(24)14-8-10-21-11-9-14)16(12-15)18(23)13-4-2-1-3-5-13/h1-12,18,23H,(H,22,24) |
| InChI Key | PFDCOZXELJAUTR-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2)Cl)NC(=O)C3=CC=NC=C3)O |
| CAS | |
| Splash | |
| Other Names | AA-1954 |
| PubChem | 92401 |