Systematic / IUPAC Name: 2-[[2-(3-Chlorophenyl)oxiran-2-yl]methyl]-2-ethylindene-1,3-dione
ID: Reference13466
Other Names: AA-1955
Formula: C20H17ClO3
Class: Pesticides/Herbicides
Indanofan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 7820 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/20/2025 9:21:47 AM |
| InChI | InChI=1S/C20H17ClO3/c1-2-19(17(22)15-8-3-4-9-16(15)18(19)23)11-20(12-24-20)13-6-5-7-14(21)10-13/h3-10H,2,11-12H2,1H3 |
| InChI Key | PMAAYIYCDXGUAP-UHFFFAOYSA-N |
| Canonical SMILES | CCC1(C(=O)C2=CC=CC=C2C1=O)CC3(CO3)C4=CC(=CC=C4)Cl |
| CAS | |
| Splash | |
| Other Names | AA-1955 |
| PubChem | 11046097 |