Systematic / IUPAC Name: (3-Methyl-5-propan-2-ylphenyl) N-methylcarbamate
ID: Reference13468
Other Names: AA-1897
Formula: C12H17NO2
Class: Pesticides/Herbicides
Promecarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 948 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/30/2025 10:37:45 AM |
| InChI | InChI=1S/C12H17NO2/c1-8(2)10-5-9(3)6-11(7-10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) |
| InChI Key | DTAPQAJKAFRNJB-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1)OC(=O)NC)C(C)C |
| CAS | |
| Splash | |
| Other Names | AA-1897 |
| PubChem | 17516 |