Systematic / IUPAC Name: Propan-2-yl 2-[amino(methoxy)phosphinothioyl]oxybenzoate
ID: Reference13471
Other Names: AA-1959
Formula: C11H16NO4PS
Class: Pesticides/Herbicides
Isocarbophos mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1663 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/4/2025 2:17:37 PM |
| InChI | InChI=1S/C11H16NO4PS/c1-8(2)15-11(13)9-6-4-5-7-10(9)16-17(12,18)14-3/h4-8H,1-3H3,(H2,12,18) |
| InChI Key | YFVOXLJXJBQDEF-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C1=CC=CC=C1OP(=S)(N)OC |
| CAS | |
| Splash | |
| Other Names | AA-1959 |
| PubChem | 90479 |