Systematic / IUPAC Name: Dipropan-2-yl 2-(1,3-dithiolan-2-ylidene)propanedioate
ID: Reference13473
Other Names: AA-1961
Formula: C12H18O4S2
Class: Pesticides/Herbicides
Isoprothiolane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1313 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/4/2025 1:13:59 PM |
| InChI | InChI=1S/C12H18O4S2/c1-7(2)15-10(13)9(11(14)16-8(3)4)12-17-5-6-18-12/h7-8H,5-6H2,1-4H3 |
| InChI Key | UFHLMYOGRXOCSL-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C(=C1SCCS1)C(=O)OC(C)C |
| CAS | |
| Splash | |
| Other Names | AA-1961 |
| PubChem |
39681 |