Systematic / IUPAC Name: 5-Chloro-4-(4-methylphenyl)-1H-imidazole-2-carbonitrile
ID: Reference13475
Other Names: AA-2056
Formula: C11H8ClN3
Class: Pesticides/Herbicides
Cyazofamid-dessulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 680 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/4/2025 12:54:47 PM |
| InChI | InChI=1S/C11H8ClN3/c1-7-2-4-8(5-3-7)10-11(12)15-9(6-13)14-10/h2-5H,1H3,(H,14,15) |
| InChI Key | AHLIZUWPYRQFHY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C2=C(NC(=N2)C#N)Cl |
| CAS | |
| Splash | |
| Other Names | AA-2056 |
| PubChem | 10910992 |