Systematic / IUPAC Name:
ID: Reference13476
Other Names: AA-2057
Formula: C5H6BrN3O
Class: Pesticides/Herbicides
5-Bromo-N-methyl-1H-pyrazole-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 888 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/4/2025 1:00:44 PM |
| InChI | InChI=1S/C5H6BrN3O/c1-7-5(10)3-2-4(6)9-8-3/h2H,1H3,(H,7,10)(H,8,9) |
| InChI Key | LOYJZLKXTLAMJX-UHFFFAOYSA-N |
| Canonical SMILES | CNC(=O)C1=NNC(=C1)Br |
| CAS | |
| Splash | |
| Other Names | AA-2057 |